UK-5099, CAS [[56396-35-1]]
Catalog Number:
APE-A3899
- Images (1)
| Article Name: | UK-5099, CAS [[56396-35-1]] |
| Biozol Catalog Number: | APE-A3899 |
| Supplier Catalog Number: | A3899 |
| Alternative Catalog Number: | APE-A3899-10MG,APE-A3899-50MG |
| Manufacturer: | ApexBio |
| Category: | Biochemikalien |
| Alternative Names: | PF-1005023,UK5099,UK 5099,PF1005023,PF 1005023 |
| MCTs and MPC inhibitor |
| Molecular Weight: | 288.3 |
| Purity: | 0.9941 |
| Sequence: | NCC(C(O)=O)=Cc(c1c2cccc1)c[n]2-c1ccccc1 |
| CAS Number: | [56396-35-1] |
| Formula: | C18H12N2O2 |
|
|
Product Guarantee and Expert Support
