4-Methoxy-1,3-phenylenediamine sulfate hydrate - dangerous good and controlled substance, CAS [[123333-56-2]]
Catalog Number:
CBS-FM172430
| Article Name: |
4-Methoxy-1,3-phenylenediamine sulfate hydrate - dangerous good and controlled substance, CAS [[123333-56-2]] |
| Biozol Catalog Number: |
CBS-FM172430 |
| Supplier Catalog Number: |
FM172430 |
| Alternative Catalog Number: |
CBS-FM172430-1G, CBS-FM172430-2G, CBS-FM172430-5G, CBS-FM172430-10G, CBS-FM172430-25G |
| Manufacturer: |
Biosynth |
| Category: |
Biochemikalien |
| Molecular Weight: |
236.26 g/mol |
| Sequence: |
COC1=C(C=C(C=C1)N)N.O.OS(=O)(=O)O |
| CAS Number: |
[123333-56-2] |
| Formula: |
C7H10N2OH2O4SxH2O |