Bisphenol A-d16 - dangerous good and controlled substance, CAS [[96210-87-6]]
Catalog Number:
CBS-WDA21087
| Article Name: |
Bisphenol A-d16 - dangerous good and controlled substance, CAS [[96210-87-6]] |
| Biozol Catalog Number: |
CBS-WDA21087 |
| Supplier Catalog Number: |
WDA21087 |
| Alternative Catalog Number: |
CBS-WDA21087-25MG, CBS-WDA21087-50MG, CBS-WDA21087-100MG, CBS-WDA21087-250MG, CBS-WDA21087-500MG |
| Manufacturer: |
Biosynth |
| Category: |
Biochemikalien |
| Molecular Weight: |
244.38 g/mol |
| Sequence: |
C(C([2H])([2H])[2H])(C([2H])([2H])[2H])(C1=C(C(=C(O[2H])C(=C1[2H])[2H])[2H])[2H])C2=C(C(=C(O[2H])C(=C2[2H])[2H])[2H])[2H] |
| CAS Number: |
[96210-87-6] |
| Formula: |
C15D16O2 |