Bromadiolone-d5 (Mixture of Diasteromers) - Dangerous Goods
Catalog Number:
TOR-B678202
| Article Name: |
Bromadiolone-d5 (Mixture of Diasteromers) - Dangerous Goods |
| Biozol Catalog Number: |
TOR-B678202 |
| Supplier Catalog Number: |
B678202 |
| Alternative Catalog Number: |
TOR-B678202-1MG,TOR-B678202-5MG |
| Manufacturer: |
Toronto Research Chemicals |
| Category: |
Biochemikalien |
| Alternative Names: |
Bromadiolone-d5 (phenyl-d5) (mixture of diastereomers), Bromadiolone-D5 (phenyl-D5), 3-[alpha-[p-(p-Bromophenyl)-beta-hydroxyphenethyl]benzyl-2,3,4,5,6-d5]-4-hydroxycoumarin, 3-[3-(4-Bromo[1,1-biphenyl]-4-yl)-3-hydroxy-1-(phenyl-d5)propyl]-4-hydroxy-2H-1-benzopyran-2-one |
| Molecular Weight: |
532436 |
| Form: |
Neat |
| Sequence: |
[2H]c1c([2H])c([2H])c(C(CC(O)c2ccc(cc2)c3ccc(Br)cc3)C4=C(O)c5ccccc5OC4=O)c([2H])c1[2H] |
| Formula: |
C30 D5 H18 Br O4 |
|
B678202 |
|
B678202 |