2,5-Dinitrophenol (Wetted with water >15%) - Dangerous Goods, CAS [[329-71-5]]
Catalog Number:
TOR-D494358
| Article Name: |
2,5-Dinitrophenol (Wetted with water >15%) - Dangerous Goods, CAS [[329-71-5]] |
| Biozol Catalog Number: |
TOR-D494358 |
| Supplier Catalog Number: |
D494358 |
| Alternative Catalog Number: |
TOR-D494358-100MG,TOR-D494358-500MG,TOR-D494358-50MG |
| Manufacturer: |
Toronto Research Chemicals |
| Category: |
Biochemikalien |
| Alternative Names: |
Phenol, 2,5-dinitro-, 2,5-Dinitrophenol, 2,5-DNP, NSC 90441, Phenol, gamma-dinitro-, gamma-Dinitrophenol |
| Molecular Weight: |
184.11 |
| Purity: |
>95% (HPLC) |
| Form: |
Neat |
| Sequence: |
Oc1cc(ccc1[N+](=O)[O-])[N+](=O)[O-] |
| CAS Number: |
[329-71-5] |
| Formula: |
C6 H4 N2 O5 |
|
D494358 |
|
D494358 |