(6E,10E)-7,11,15-Trimethyl-3-oxohexadeca-6,10,14-trienoic Acid, Ethyl Ester,(Mixture of Isomers), CAS [[141538-75-2]] Preis auf Anfrage
Catalog Number:
TOR-T796580
| Article Name: |
(6E,10E)-7,11,15-Trimethyl-3-oxohexadeca-6,10,14-trienoic Acid, Ethyl Ester,(Mixture of Isomers), CAS [[141538-75-2]] Preis auf Anfrage |
| Biozol Catalog Number: |
TOR-T796580 |
| Supplier Catalog Number: |
T796580 |
| Alternative Catalog Number: |
TOR-T796580-500MG,TOR-T796580-5G |
| Manufacturer: |
Toronto Research Chemicals |
| Category: |
Biochemikalien |
| Molecular Weight: |
334.49 |
| Form: |
Neat |
| Sequence: |
CCOC(=O)CC(=O)CC\C=C(/C)\CC\C=C(/C)\CCC=C(C)C |
| CAS Number: |
[141538-75-2] |
| Formula: |
C21 H34 O3 |
![]()
|
T796580 |
